C26H30N2O7 — CID 3407684
methyl 5-[[4-[(4-butan-2-yloxy-3-ethoxy-5-prop-2-enylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 3407684) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is methyl 5-[[4-[(4-butan-2-yloxy-3-ethoxy-5-prop-2-enylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[(4-butan-2-yloxy-3-ethoxy-5-prop-2-enylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3407684 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | methyl 5-[[4-[(4-butan-2-yloxy-3-ethoxy-5-prop-2-enylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | C=CCc1cc(C=C2NC(=O)N(Cc3ccc(C(=O)OC)o3)C2=O)cc(OCC)c1OC(C)CC |
| InChI | InChI=1S/C26H30N2O7/c1-6-9-18-12-17(14-22(33-8-3)23(18)34-16(4)7-2)13-20-24(29)28(26(31)27-20)15-19-10-11-21(35-19)25(30)32-5/h6,10-14,16H,1,7-9,15H2,2-5H3,(H,27,31) |
| InChIKey | OWYBBNHTOFZAAZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|