C21H21IN2O6 — CID 126402766
methyl 5-[[(4Z)-4-[[3-iodo-4-[(2-methylpropan-2-yl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126402766) has the molecular formula C21H21IN2O6 and a molecular weight of 524.31 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3-iodo-4-[(2-methylpropan-2-yl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3-iodo-4-[(2-methylpropan-2-yl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126402766 |
| Molecular Formula | C21H21IN2O6 |
| Molecular Weight | 524.31 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3-iodo-4-[(2-methylpropan-2-yl)oxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3ccc(OC(C)(C)C)c(I)c3)C2=O)o1 |
| InChI | InChI=1S/C21H21IN2O6/c1-21(2,3)30-16-7-5-12(9-14(16)22)10-15-18(25)24(20(27)23-15)11-13-6-8-17(29-13)19(26)28-4/h5-10H,11H2,1-4H3,(H,23,27)/b15-10- |
| InChIKey | BZXGXULHYKDGPK-GDNBJRDFSA-N |
| XLogP | 3.94 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|