C25H20N2O8 — CID 3539229
methyl 5-[[4-[(4-benzoyloxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 3539229) has the molecular formula C25H20N2O8 and a molecular weight of 476.44 g/mol. Its IUPAC name is methyl 5-[[4-[(4-benzoyloxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[(4-benzoyloxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3539229 |
| Molecular Formula | C25H20N2O8 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | methyl 5-[[4-[(4-benzoyloxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3ccc(OC(=O)c4ccccc4)c(OC)c3)C2=O)o1 |
| InChI | InChI=1S/C25H20N2O8/c1-32-21-13-15(8-10-19(21)35-23(29)16-6-4-3-5-7-16)12-18-22(28)27(25(31)26-18)14-17-9-11-20(34-17)24(30)33-2/h3-13H,14H2,1-2H3,(H,26,31) |
| InChIKey | DVSYVDXPTMQISR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|