C17H12Cl2N2O5 — CID 3954499
methyl 5-[[4-[(3,4-dichlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 3954499) has the molecular formula C17H12Cl2N2O5 and a molecular weight of 395.20 g/mol. Its IUPAC name is methyl 5-[[4-[(3,4-dichlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-[(3,4-dichlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3954499 |
| Molecular Formula | C17H12Cl2N2O5 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | methyl 5-[[4-[(3,4-dichlorophenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)NC(=Cc3ccc(Cl)c(Cl)c3)C2=O)o1 |
| InChI | InChI=1S/C17H12Cl2N2O5/c1-25-16(23)14-5-3-10(26-14)8-21-15(22)13(20-17(21)24)7-9-2-4-11(18)12(19)6-9/h2-7H,8H2,1H3,(H,20,24) |
| InChIKey | LVCSMSRJLBRDKX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|