C25H19Cl2IN2O7 — CID 126404393
methyl 5-[[(4Z)-4-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404393) has the molecular formula C25H19Cl2IN2O7 and a molecular weight of 657.24 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404393 |
| Molecular Formula | C25H19Cl2IN2O7 |
| Molecular Weight | 657.24 g/mol |
| Exact Mass | 655.96 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-[(3,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(I)c(OCc4ccc(Cl)c(Cl)c4)c(OC)c3)C2=O)o1 |
| InChI | InChI=1S/C25H19Cl2IN2O7/c1-34-21-10-14(8-18(28)22(21)36-12-13-3-5-16(26)17(27)7-13)9-19-23(31)30(25(33)29-19)11-15-4-6-20(37-15)24(32)35-2/h3-10H,11-12H2,1-2H3,(H,29,33)/b19-9- |
| InChIKey | NVXRZGFOSQIEBI-OCKHKDLRSA-N |
| XLogP | 5.66 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.24 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|