C26H23ClN2O8 — CID 126407790
methyl 5-[[(4Z)-4-[[4-[(2-chlorophenyl)methoxy]-3,5-dimethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126407790) has the molecular formula C26H23ClN2O8 and a molecular weight of 526.93 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[4-[(2-chlorophenyl)methoxy]-3,5-dimethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[4-[(2-chlorophenyl)methoxy]-3,5-dimethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126407790 |
| Molecular Formula | C26H23ClN2O8 |
| Molecular Weight | 526.93 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[4-[(2-chlorophenyl)methoxy]-3,5-dimethoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(OC)c(OCc4ccccc4Cl)c(OC)c3)C2=O)o1 |
| InChI | InChI=1S/C26H23ClN2O8/c1-33-21-11-15(12-22(34-2)23(21)36-14-16-6-4-5-7-18(16)27)10-19-24(30)29(26(32)28-19)13-17-8-9-20(37-17)25(31)35-3/h4-12H,13-14H2,1-3H3,(H,28,32)/b19-10- |
| InChIKey | ZJCFJFHDDGJJIP-GRSHGNNSSA-N |
| XLogP | 4.41 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|