C25H17Cl2N3O6 — CID 126404897
methyl 5-[[(4Z)-4-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126404897) has the molecular formula C25H17Cl2N3O6 and a molecular weight of 526.33 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126404897 |
| Molecular Formula | C25H17Cl2N3O6 |
| Molecular Weight | 526.33 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[3,5-dichloro-4-[(2-cyanophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(Cl)c(OCc4ccccc4C#N)c(Cl)c3)C2=O)o1 |
| InChI | InChI=1S/C25H17Cl2N3O6/c1-34-24(32)21-7-6-17(36-21)12-30-23(31)20(29-25(30)33)10-14-8-18(26)22(19(27)9-14)35-13-16-5-3-2-4-15(16)11-28/h2-10H,12-13H2,1H3,(H,29,33)/b20-10- |
| InChIKey | PBJNTKBGGNXCNU-JMIUGGIZSA-N |
| XLogP | 4.92 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|