C26H19Cl2N3O3 — CID 126259722
2-[[2,6-dichloro-4-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 126259722) has the molecular formula C26H19Cl2N3O3 and a molecular weight of 492.36 g/mol. Its IUPAC name is 2-[[2,6-dichloro-4-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dichloro-4-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126259722 |
| Molecular Formula | C26H19Cl2N3O3 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 2-[[2,6-dichloro-4-[(E)-[1-[(4-methylphenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | Cc1ccc(CN2C(=O)N/C(=C/c3cc(Cl)c(OCc4ccccc4C#N)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C26H19Cl2N3O3/c1-16-6-8-17(9-7-16)14-31-25(32)23(30-26(31)33)12-18-10-21(27)24(22(28)11-18)34-15-20-5-3-2-4-19(20)13-29/h2-12H,14-15H2,1H3,(H,30,33)/b23-12+ |
| InChIKey | ZOFUBSOKZQMWMZ-FSJBWODESA-N |
| XLogP | 5.85 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|