C27H22ClN3O4 — CID 126251779
2-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-chloro-6-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 126251779) has the molecular formula C27H22ClN3O4 and a molecular weight of 487.94 g/mol. Its IUPAC name is 2-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-chloro-6-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-chloro-6-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126251779 |
| Molecular Formula | C27H22ClN3O4 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 2-[[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-chloro-6-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(Cc3ccccc3)C2=O)cc(Cl)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H22ClN3O4/c1-2-34-24-14-19(12-22(28)25(24)35-17-21-11-7-6-10-20(21)15-29)13-23-26(32)31(27(33)30-23)16-18-8-4-3-5-9-18/h3-14H,2,16-17H2,1H3,(H,30,33)/b23-13+ |
| InChIKey | WIPFUUNEFOZXGI-YDZHTSKRSA-N |
| XLogP | 5.28 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|