C23H22IN3O4 — CID 126251766
2-[[4-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile (PubChem CID 126251766) has the molecular formula C23H22IN3O4 and a molecular weight of 531.35 g/mol. Its IUPAC name is 2-[[4-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126251766 |
| Molecular Formula | C23H22IN3O4 |
| Molecular Weight | 531.35 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | 2-[[4-[(E)-(2,5-dioxo-1-propylimidazolidin-4-ylidene)methyl]-2-ethoxy-6-iodophenoxy]methyl]benzonitrile |
| SMILES | CCCN1C(=O)N/C(=C/c2cc(I)c(OCc3ccccc3C#N)c(OCC)c2)C1=O |
| InChI | InChI=1S/C23H22IN3O4/c1-3-9-27-22(28)19(26-23(27)29)11-15-10-18(24)21(20(12-15)30-4-2)31-14-17-8-6-5-7-16(17)13-25/h5-8,10-12H,3-4,9,14H2,1-2H3,(H,26,29)/b19-11+ |
| InChIKey | WEBVXGLJCFQEGN-YBFXNURJSA-N |
| XLogP | 4.44 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|