C28H23IN4O6 — CID 126251179
2-[(4E)-4-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126251179) has the molecular formula C28H23IN4O6 and a molecular weight of 638.42 g/mol. Its IUPAC name is 2-[(4E)-4-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126251179 |
| Molecular Formula | C28H23IN4O6 |
| Molecular Weight | 638.42 g/mol |
| Exact Mass | 638.07 |
| IUPAC Name | 2-[(4E)-4-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2cc(I)c(OCc3ccccc3C#N)c(OC)c2)C1=O |
| InChI | InChI=1S/C28H23IN4O6/c1-37-23-10-6-5-9-21(23)31-25(34)15-33-27(35)22(32-28(33)36)12-17-11-20(29)26(24(13-17)38-2)39-16-19-8-4-3-7-18(19)14-30/h3-13H,15-16H2,1-2H3,(H,31,34)(H,32,36)/b22-12+ |
| InChIKey | LYRJQQHJWUHGEE-WSDLNYQXSA-N |
| XLogP | 4.29 |
| TPSA | 129.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|