C26H23IN4O5 — CID 3504760
N'-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-methoxyphenyl)propanediamide (PubChem CID 3504760) has the molecular formula C26H23IN4O5 and a molecular weight of 598.40 g/mol. Its IUPAC name is N'-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-methoxyphenyl)propanediamide.
| Compound Name | N'-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 3504760 |
| Molecular Formula | C26H23IN4O5 |
| Molecular Weight | 598.40 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | N'-[[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(2-methoxyphenyl)propanediamide |
| SMILES | COc1ccccc1NC(=O)CC(=O)NN=Cc1cc(I)c(OCc2ccccc2C#N)c(OC)c1 |
| InChI | InChI=1S/C26H23IN4O5/c1-34-22-10-6-5-9-21(22)30-24(32)13-25(33)31-29-15-17-11-20(27)26(23(12-17)35-2)36-16-19-8-4-3-7-18(19)14-28/h3-12,15H,13,16H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | BSYULKSZIQMYQL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|