C21H17IN2O4 — CID 1105513
ethyl (E)-2-cyano-3-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enoate (PubChem CID 1105513) has the molecular formula C21H17IN2O4 and a molecular weight of 488.28 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 1105513 |
| Molecular Formula | C21H17IN2O4 |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cc(I)c(OCc2ccccc2C#N)c(OC)c1 |
| InChI | InChI=1S/C21H17IN2O4/c1-3-27-21(25)17(12-24)8-14-9-18(22)20(19(10-14)26-2)28-13-16-7-5-4-6-15(16)11-23/h4-10H,3,13H2,1-2H3/b17-8+ |
| InChIKey | CPXBNEWYRBBJSN-CAOOACKPSA-N |
| XLogP | 4.22 |
| TPSA | 92.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|