C24H17FINO3 — CID 21381900
(E)-2-benzoyl-3-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enenitrile (PubChem CID 21381900) has the molecular formula C24H17FINO3 and a molecular weight of 513.31 g/mol. Its IUPAC name is (E)-2-benzoyl-3-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-2-benzoyl-3-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 21381900 |
| Molecular Formula | C24H17FINO3 |
| Molecular Weight | 513.31 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | (E)-2-benzoyl-3-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)C(=O)c2ccccc2)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C24H17FINO3/c1-29-22-13-16(11-19(14-27)23(28)17-7-3-2-4-8-17)12-21(26)24(22)30-15-18-9-5-6-10-20(18)25/h2-13H,15H2,1H3/b19-11+ |
| InChIKey | UGGKYFOLBUHPKP-YBFXNURJSA-N |
| XLogP | 5.81 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.31 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|