C27H22IN3O3 — CID 126234492
(Z)-2-cyano-3-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126234492) has the molecular formula C27H22IN3O3 and a molecular weight of 563.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126234492 |
| Molecular Formula | C27H22IN3O3 |
| Molecular Weight | 563.40 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | (Z)-2-cyano-3-[4-[(2-cyanophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)cc(I)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H22IN3O3/c1-18(20-8-4-3-5-9-20)31-27(32)23(16-30)12-19-13-24(28)26(25(14-19)33-2)34-17-22-11-7-6-10-21(22)15-29/h3-14,18H,17H2,1-2H3,(H,31,32)/b23-12-/t18-/m0/s1 |
| InChIKey | WYAGOASOVXMUQK-NVIPHDJISA-N |
| XLogP | 5.53 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|