C27H23Cl2IN2O3 — CID 126245757
(Z)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126245757) has the molecular formula C27H23Cl2IN2O3 and a molecular weight of 621.30 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126245757 |
| Molecular Formula | C27H23Cl2IN2O3 |
| Molecular Weight | 621.30 g/mol |
| Exact Mass | 620.01 |
| IUPAC Name | (Z)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H23Cl2IN2O3/c1-3-34-25-13-18(11-21(15-31)27(33)32-17(2)19-7-5-4-6-8-19)12-24(30)26(25)35-16-20-9-10-22(28)14-23(20)29/h4-14,17H,3,16H2,1-2H3,(H,32,33)/b21-11-/t17-/m0/s1 |
| InChIKey | ZCRPFZAWIIWVOU-QREGZJMFSA-N |
| XLogP | 7.36 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.30 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|