C28H26ClN3O4 — CID 126227097
(Z)-3-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126227097) has the molecular formula C28H26ClN3O4 and a molecular weight of 503.99 g/mol. Its IUPAC name is (Z)-3-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126227097 |
| Molecular Formula | C28H26ClN3O4 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (Z)-3-[4-(2-anilino-2-oxoethoxy)-3-chloro-5-ethoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)cc(Cl)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H26ClN3O4/c1-3-35-25-16-20(14-22(17-30)28(34)31-19(2)21-10-6-4-7-11-21)15-24(29)27(25)36-18-26(33)32-23-12-8-5-9-13-23/h4-16,19H,3,18H2,1-2H3,(H,31,34)(H,32,33)/b22-14-/t19-/m0/s1 |
| InChIKey | HMSOQFWXVKQJQP-MAGMUUGSSA-N |
| XLogP | 5.54 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|