C20H16BrClN2O4 — CID 126247957
2-[2-bromo-6-chloro-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]phenoxy]acetic acid (PubChem CID 126247957) has the molecular formula C20H16BrClN2O4 and a molecular weight of 463.72 g/mol. Its IUPAC name is 2-[2-bromo-6-chloro-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-chloro-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126247957 |
| Molecular Formula | C20H16BrClN2O4 |
| Molecular Weight | 463.72 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 2-[2-bromo-6-chloro-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]phenoxy]acetic acid |
| SMILES | C[C@H](NC(=O)/C(C#N)=C\c1cc(Cl)c(OCC(=O)O)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C20H16BrClN2O4/c1-12(14-5-3-2-4-6-14)24-20(27)15(10-23)7-13-8-16(21)19(17(22)9-13)28-11-18(25)26/h2-9,12H,11H2,1H3,(H,24,27)(H,25,26)/b15-7-/t12-/m0/s1 |
| InChIKey | YMQOWTRJVKRHEP-CUTJPZLCSA-N |
| XLogP | 4.35 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|