C21H18Br2N2O2 — CID 31057164
(E)-2-cyano-3-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 31057164) has the molecular formula C21H18Br2N2O2 and a molecular weight of 490.20 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 31057164 |
| Molecular Formula | C21H18Br2N2O2 |
| Molecular Weight | 490.20 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | (E)-2-cyano-3-(3,5-dibromo-4-prop-2-enoxyphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C=CCOc1c(Br)cc(/C=C(\C#N)C(=O)N[C@H](C)c2ccccc2)cc1Br |
| InChI | InChI=1S/C21H18Br2N2O2/c1-3-9-27-20-18(22)11-15(12-19(20)23)10-17(13-24)21(26)25-14(2)16-7-5-4-6-8-16/h3-8,10-12,14H,1,9H2,2H3,(H,25,26)/b17-10+/t14-/m1/s1 |
| InChIKey | ZPJWOWAJNFQABW-NGWPFTMJSA-N |
| XLogP | 5.56 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.20 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|