C25H19Br2N3O4 — CID 126236686
(Z)-2-cyano-3-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126236686) has the molecular formula C25H19Br2N3O4 and a molecular weight of 585.25 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126236686 |
| Molecular Formula | C25H19Br2N3O4 |
| Molecular Weight | 585.25 g/mol |
| Exact Mass | 582.97 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1cc(Br)c(OCc2cccc([N+](=O)[O-])c2)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C25H19Br2N3O4/c1-16(19-7-3-2-4-8-19)29-25(31)20(14-28)10-18-12-22(26)24(23(27)13-18)34-15-17-6-5-9-21(11-17)30(32)33/h2-13,16H,15H2,1H3,(H,29,31)/b20-10-/t16-/m1/s1 |
| InChIKey | DUIJYUWZFHKBLX-HSGPEQJXSA-N |
| XLogP | 6.48 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.25 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|