C25H18Br2Cl2N2O2 — CID 126256292
(Z)-2-cyano-3-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126256292) has the molecular formula C25H18Br2Cl2N2O2 and a molecular weight of 609.15 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126256292 |
| Molecular Formula | C25H18Br2Cl2N2O2 |
| Molecular Weight | 609.15 g/mol |
| Exact Mass | 605.91 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C25H18Br2Cl2N2O2/c1-15(18-5-3-2-4-6-18)31-25(32)19(13-30)9-17-10-20(26)24(21(27)11-17)33-14-16-7-8-22(28)23(29)12-16/h2-12,15H,14H2,1H3,(H,31,32)/b19-9-/t15-/m1/s1 |
| InChIKey | PQQHIKWHBFQULC-HBFFOVPNSA-N |
| XLogP | 7.88 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.15 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|