C28H25BrN2O5 — CID 126238666
4-[[2-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126238666) has the molecular formula C28H25BrN2O5 and a molecular weight of 549.42 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126238666 |
| Molecular Formula | C28H25BrN2O5 |
| Molecular Weight | 549.42 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | 4-[[2-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1R)-1-phenylethyl]amino]prop-1-enyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)N[C@H](C)c2ccccc2)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H25BrN2O5/c1-3-35-25-15-20(13-23(16-30)27(32)31-18(2)21-7-5-4-6-8-21)14-24(29)26(25)36-17-19-9-11-22(12-10-19)28(33)34/h4-15,18H,3,17H2,1-2H3,(H,31,32)(H,33,34)/b23-13-/t18-/m1/s1 |
| InChIKey | IILSCYIRNCKTQM-VLZFXTDASA-N |
| XLogP | 5.91 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|