C26H22N2O4 — CID 126245006
4-[[4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]phenoxy]methyl]benzoic acid (PubChem CID 126245006) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 4-[[4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126245006 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-[[4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]phenoxy]methyl]benzoic acid |
| SMILES | C[C@H](NC(=O)/C(C#N)=C\c1ccc(OCc2ccc(C(=O)O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O4/c1-18(21-5-3-2-4-6-21)28-25(29)23(16-27)15-19-9-13-24(14-10-19)32-17-20-7-11-22(12-8-20)26(30)31/h2-15,18H,17H2,1H3,(H,28,29)(H,30,31)/b23-15-/t18-/m0/s1 |
| InChIKey | MBCMIRHWXYNDSF-JYBCESJWSA-N |
| XLogP | 4.75 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|