C24H18N2O4 — CID 2435484
4-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 2435484) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2435484 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(OCc2ccccc2)cc1)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H18N2O4/c25-15-20(23(27)26-21-10-8-19(9-11-21)24(28)29)14-17-6-12-22(13-7-17)30-16-18-4-2-1-3-5-18/h1-14H,16H2,(H,26,27)(H,28,29)/b20-14+ |
| InChIKey | IRPWCHDYDCQWDB-XSFVSMFZSA-N |
| XLogP | 4.51 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|