C26H20N2O6 — CID 126071456
4-[[3-[(Z)-2-cyano-3-(4-methoxycarbonylanilino)-3-oxoprop-1-enyl]phenoxy]methyl]benzoic acid (PubChem CID 126071456) has the molecular formula C26H20N2O6 and a molecular weight of 456.45 g/mol. Its IUPAC name is 4-[[3-[(Z)-2-cyano-3-(4-methoxycarbonylanilino)-3-oxoprop-1-enyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[3-[(Z)-2-cyano-3-(4-methoxycarbonylanilino)-3-oxoprop-1-enyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126071456 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 4-[[3-[(Z)-2-cyano-3-(4-methoxycarbonylanilino)-3-oxoprop-1-enyl]phenoxy]methyl]benzoic acid |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C\c2cccc(OCc3ccc(C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C26H20N2O6/c1-33-26(32)20-9-11-22(12-10-20)28-24(29)21(15-27)13-18-3-2-4-23(14-18)34-16-17-5-7-19(8-6-17)25(30)31/h2-14H,16H2,1H3,(H,28,29)(H,30,31)/b21-13- |
| InChIKey | FYMHAZJSADEFOB-BKUYFWCQSA-N |
| XLogP | 4.30 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|