C25H21N3O6S — CID 17268553
methyl 4-[[4-[(E)-2-cyano-3-oxo-3-(4-sulfamoylanilino)prop-1-enyl]phenoxy]methyl]benzoate (PubChem CID 17268553) has the molecular formula C25H21N3O6S and a molecular weight of 491.53 g/mol. Its IUPAC name is methyl 4-[[4-[(E)-2-cyano-3-oxo-3-(4-sulfamoylanilino)prop-1-enyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-[(E)-2-cyano-3-oxo-3-(4-sulfamoylanilino)prop-1-enyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 17268553 |
| Molecular Formula | C25H21N3O6S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | methyl 4-[[4-[(E)-2-cyano-3-oxo-3-(4-sulfamoylanilino)prop-1-enyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=C(\C#N)C(=O)Nc3ccc(S(N)(=O)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O6S/c1-33-25(30)19-6-2-18(3-7-19)16-34-22-10-4-17(5-11-22)14-20(15-26)24(29)28-21-8-12-23(13-9-21)35(27,31)32/h2-14H,16H2,1H3,(H,28,29)(H2,27,31,32)/b20-14+ |
| InChIKey | ZMJPVVBAYGHCPQ-XSFVSMFZSA-N |
| XLogP | 3.25 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|