C28H26N2O4 — CID 18558485
butyl 4-[[(Z)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 18558485) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is butyl 4-[[(Z)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | butyl 4-[[(Z)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 18558485 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | butyl 4-[[(Z)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)/C(C#N)=C\c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O4/c1-2-3-17-33-28(32)23-11-13-25(14-12-23)30-27(31)24(19-29)18-21-9-15-26(16-10-21)34-20-22-7-5-4-6-8-22/h4-16,18H,2-3,17,20H2,1H3,(H,30,31)/b24-18- |
| InChIKey | WXZJHQITWUWNHL-MOHJPFBDSA-N |
| XLogP | 5.77 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|