C24H19N3O6S — CID 3137911
[4-[2-cyano-3-oxo-3-(4-sulfamoylanilino)prop-1-enyl]phenyl] 4-methoxybenzoate (PubChem CID 3137911) has the molecular formula C24H19N3O6S and a molecular weight of 477.50 g/mol. Its IUPAC name is [4-[2-cyano-3-oxo-3-(4-sulfamoylanilino)prop-1-enyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[2-cyano-3-oxo-3-(4-sulfamoylanilino)prop-1-enyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3137911 |
| Molecular Formula | C24H19N3O6S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | [4-[2-cyano-3-oxo-3-(4-sulfamoylanilino)prop-1-enyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C=C(C#N)C(=O)Nc3ccc(S(N)(=O)=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H19N3O6S/c1-32-20-10-4-17(5-11-20)24(29)33-21-8-2-16(3-9-21)14-18(15-25)23(28)27-19-6-12-22(13-7-19)34(26,30)31/h2-14H,1H3,(H,27,28)(H2,26,30,31) |
| InChIKey | OERJKQSJKLXEPY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|