C25H17N3O3 — CID 1187005
[4-[(Z)-2-cyano-3-(4-cyanoanilino)-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate (PubChem CID 1187005) has the molecular formula C25H17N3O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-(4-cyanoanilino)-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[(Z)-2-cyano-3-(4-cyanoanilino)-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 1187005 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [4-[(Z)-2-cyano-3-(4-cyanoanilino)-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(/C=C(/C#N)C(=O)Nc3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H17N3O3/c1-17-2-8-20(9-3-17)25(30)31-23-12-6-18(7-13-23)14-21(16-27)24(29)28-22-10-4-19(15-26)5-11-22/h2-14H,1H3,(H,28,29)/b21-14- |
| InChIKey | LOUUBGVZSQLLIV-STZFKDTASA-N |
| XLogP | 4.63 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|