C28H26N2O4 — CID 17279964
methyl 4-[[4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]phenoxy]methyl]benzoate (PubChem CID 17279964) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl 4-[[4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 17279964 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | methyl 4-[[4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=C(\C#N)C(=O)Nc3c(C)cc(C)cc3C)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O4/c1-18-13-19(2)26(20(3)14-18)30-27(31)24(16-29)15-21-7-11-25(12-8-21)34-17-22-5-9-23(10-6-22)28(32)33-4/h5-15H,17H2,1-4H3,(H,30,31)/b24-15+ |
| InChIKey | KIRIUIFFUXTKAM-BUVRLJJBSA-N |
| XLogP | 5.52 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|