C26H21BrN2O3 — CID 2350270
[4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]phenyl] 4-bromobenzoate (PubChem CID 2350270) has the molecular formula C26H21BrN2O3 and a molecular weight of 489.37 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 2350270 |
| Molecular Formula | C26H21BrN2O3 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | [4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]phenyl] 4-bromobenzoate |
| SMILES | Cc1cc(C)c(NC(=O)/C(C#N)=C/c2ccc(OC(=O)c3ccc(Br)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H21BrN2O3/c1-16-12-17(2)24(18(3)13-16)29-25(30)21(15-28)14-19-4-10-23(11-5-19)32-26(31)20-6-8-22(27)9-7-20/h4-14H,1-3H3,(H,29,30)/b21-14+ |
| InChIKey | LKZMMUMOJHIRME-KGENOOAVSA-N |
| XLogP | 6.14 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|