C27H24N2O4S — CID 18864134
methyl 2-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18864134) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is methyl 2-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18864134 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | methyl 2-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)/C(C#N)=C/c2ccc(OCc3ccccc3)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H24N2O4S/c1-32-27(31)24-22-9-5-6-10-23(22)34-26(24)29-25(30)20(16-28)15-18-11-13-21(14-12-18)33-17-19-7-3-2-4-8-19/h2-4,7-8,11-15H,5-6,9-10,17H2,1H3,(H,29,30)/b20-15+ |
| InChIKey | YZKGVLGEQHTLQR-HMMYKYKNSA-N |
| XLogP | 5.54 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|