C28H25BrN2O4S — CID 21382048
ethyl 2-[[(E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 21382048) has the molecular formula C28H25BrN2O4S and a molecular weight of 565.49 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 21382048 |
| Molecular Formula | C28H25BrN2O4S |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-bromo-4-phenylmethoxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2ccc(OCc3ccccc3)c(Br)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C28H25BrN2O4S/c1-2-34-28(33)25-21-10-6-7-11-24(21)36-27(25)31-26(32)20(16-30)14-19-12-13-23(22(29)15-19)35-17-18-8-4-3-5-9-18/h3-5,8-9,12-15H,2,6-7,10-11,17H2,1H3,(H,31,32)/b20-14+ |
| InChIKey | KAAVJUYOWQBBHR-XSFVSMFZSA-N |
| XLogP | 6.69 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|