C21H21BrN2O4S — CID 21382319
ethyl 2-[[(E)-3-(3-bromo-4-ethoxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 21382319) has the molecular formula C21H21BrN2O4S and a molecular weight of 477.38 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-bromo-4-ethoxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3-bromo-4-ethoxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 21382319 |
| Molecular Formula | C21H21BrN2O4S |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-bromo-4-ethoxyphenyl)-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2ccc(OCC)c(Br)c2)sc(C)c1C |
| InChI | InChI=1S/C21H21BrN2O4S/c1-5-27-17-8-7-14(10-16(17)22)9-15(11-23)19(25)24-20-18(21(26)28-6-2)12(3)13(4)29-20/h7-10H,5-6H2,1-4H3,(H,24,25)/b15-9+ |
| InChIKey | WONGMGJILBJDAA-OQLLNIDSSA-N |
| XLogP | 5.25 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|