C19H16Br2N2O4S — CID 4286850
ethyl 2-[[2-cyano-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 4286850) has the molecular formula C19H16Br2N2O4S and a molecular weight of 528.22 g/mol. Its IUPAC name is ethyl 2-[[2-cyano-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-cyano-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4286850 |
| Molecular Formula | C19H16Br2N2O4S |
| Molecular Weight | 528.22 g/mol |
| Exact Mass | 525.92 |
| IUPAC Name | ethyl 2-[[2-cyano-3-(3,5-dibromo-4-hydroxyphenyl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C#N)=Cc2cc(Br)c(O)c(Br)c2)sc(C)c1C |
| InChI | InChI=1S/C19H16Br2N2O4S/c1-4-27-19(26)15-9(2)10(3)28-18(15)23-17(25)12(8-22)5-11-6-13(20)16(24)14(21)7-11/h5-7,24H,4H2,1-3H3,(H,23,25) |
| InChIKey | NLSFUPKFGOZNGG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.22 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|