C24H21BrN2O4S — CID 6284645
ethyl 2-[[(E)-3-[5-(2-bromo-4-methylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 6284645) has the molecular formula C24H21BrN2O4S and a molecular weight of 513.41 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-[5-(2-bromo-4-methylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-[5-(2-bromo-4-methylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 6284645 |
| Molecular Formula | C24H21BrN2O4S |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | ethyl 2-[[(E)-3-[5-(2-bromo-4-methylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C/c2ccc(-c3ccc(C)cc3Br)o2)sc(C)c1C |
| InChI | InChI=1S/C24H21BrN2O4S/c1-5-30-24(29)21-14(3)15(4)32-23(21)27-22(28)16(12-26)11-17-7-9-20(31-17)18-8-6-13(2)10-19(18)25/h6-11H,5H2,1-4H3,(H,27,28)/b16-11+ |
| InChIKey | KRWOJPHXJDVIIO-LFIBNONCSA-N |
| XLogP | 6.42 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|