C27H25ClN2O6S — CID 4045714
ethyl 2-[[3-[5-(5-chloro-2-propan-2-yloxycarbonylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 4045714) has the molecular formula C27H25ClN2O6S and a molecular weight of 541.03 g/mol. Its IUPAC name is ethyl 2-[[3-[5-(5-chloro-2-propan-2-yloxycarbonylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-[5-(5-chloro-2-propan-2-yloxycarbonylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4045714 |
| Molecular Formula | C27H25ClN2O6S |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | ethyl 2-[[3-[5-(5-chloro-2-propan-2-yloxycarbonylphenyl)furan-2-yl]-2-cyanoprop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C#N)=Cc2ccc(-c3cc(Cl)ccc3C(=O)OC(C)C)o2)sc(C)c1C |
| InChI | InChI=1S/C27H25ClN2O6S/c1-6-34-27(33)23-15(4)16(5)37-25(23)30-24(31)17(13-29)11-19-8-10-22(36-19)21-12-18(28)7-9-20(21)26(32)35-14(2)3/h7-12,14H,6H2,1-5H3,(H,30,31) |
| InChIKey | FUKYRRRATPMQDA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|