C23H17ClN2O5 — CID 126198049
methyl 4-chloro-2-[5-[(E)-2-cyano-3-(2-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 126198049) has the molecular formula C23H17ClN2O5 and a molecular weight of 436.85 g/mol. Its IUPAC name is methyl 4-chloro-2-[5-[(E)-2-cyano-3-(2-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-chloro-2-[5-[(E)-2-cyano-3-(2-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126198049 |
| Molecular Formula | C23H17ClN2O5 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | methyl 4-chloro-2-[5-[(E)-2-cyano-3-(2-methoxyanilino)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1-c1ccc(/C=C(\C#N)C(=O)Nc2ccccc2OC)o1 |
| InChI | InChI=1S/C23H17ClN2O5/c1-29-21-6-4-3-5-19(21)26-22(27)14(13-25)11-16-8-10-20(31-16)18-12-15(24)7-9-17(18)23(28)30-2/h3-12H,1-2H3,(H,26,27)/b14-11+ |
| InChIKey | OAZUERCZGFGFDK-SDNWHVSQSA-N |
| XLogP | 4.94 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|