C23H17N3O6 — CID 18863845
methyl 2-[[(E)-2-cyano-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate (PubChem CID 18863845) has the molecular formula C23H17N3O6 and a molecular weight of 431.40 g/mol. Its IUPAC name is methyl 2-[[(E)-2-cyano-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-[[(E)-2-cyano-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 18863845 |
| Molecular Formula | C23H17N3O6 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | methyl 2-[[(E)-2-cyano-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)/C(C#N)=C/c1ccc(-c2ccc(C)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C23H17N3O6/c1-14-7-9-18(20(11-14)26(29)30)21-10-8-16(32-21)12-15(13-24)22(27)25-19-6-4-3-5-17(19)23(28)31-2/h3-12H,1-2H3,(H,25,27)/b15-12+ |
| InChIKey | ASKYBXLLXIRJQK-NTCAYCPXSA-N |
| XLogP | 4.50 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|