C21H13Cl2N3O4 — CID 18863606
(E)-2-cyano-N-(2,3-dichlorophenyl)-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 18863606) has the molecular formula C21H13Cl2N3O4 and a molecular weight of 442.26 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dichlorophenyl)-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dichlorophenyl)-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18863606 |
| Molecular Formula | C21H13Cl2N3O4 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dichlorophenyl)-3-[5-(4-methyl-2-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C(\C#N)C(=O)Nc3cccc(Cl)c3Cl)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H13Cl2N3O4/c1-12-5-7-15(18(9-12)26(28)29)19-8-6-14(30-19)10-13(11-24)21(27)25-17-4-2-3-16(22)20(17)23/h2-10H,1H3,(H,25,27)/b13-10+ |
| InChIKey | OXHNYQICLVRKOC-JLHYYAGUSA-N |
| XLogP | 6.02 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|