C22H16Cl2N2O2 — CID 18863448
(E)-2-cyano-3-[5-(2,6-dichlorophenyl)furan-2-yl]-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 18863448) has the molecular formula C22H16Cl2N2O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(2,6-dichlorophenyl)furan-2-yl]-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(2,6-dichlorophenyl)furan-2-yl]-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18863448 |
| Molecular Formula | C22H16Cl2N2O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (E)-2-cyano-3-[5-(2,6-dichlorophenyl)furan-2-yl]-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2ccc(-c3c(Cl)cccc3Cl)o2)c(C)c1 |
| InChI | InChI=1S/C22H16Cl2N2O2/c1-13-6-8-19(14(2)10-13)26-22(27)15(12-25)11-16-7-9-20(28-16)21-17(23)4-3-5-18(21)24/h3-11H,1-2H3,(H,26,27)/b15-11+ |
| InChIKey | QUBUEFZULMVQGD-RVDMUPIBSA-N |
| XLogP | 6.42 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|