C21H14N4O8 — CID 5083666
2-cyano-N-(2-hydroxy-4-nitrophenyl)-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 5083666) has the molecular formula C21H14N4O8 and a molecular weight of 450.36 g/mol. Its IUPAC name is 2-cyano-N-(2-hydroxy-4-nitrophenyl)-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(2-hydroxy-4-nitrophenyl)-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5083666 |
| Molecular Formula | C21H14N4O8 |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-cyano-N-(2-hydroxy-4-nitrophenyl)-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | COc1ccc(-c2ccc(C=C(C#N)C(=O)Nc3ccc([N+](=O)[O-])cc3O)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14N4O8/c1-32-14-3-5-16(18(10-14)25(30)31)20-7-4-15(33-20)8-12(11-22)21(27)23-17-6-2-13(24(28)29)9-19(17)26/h2-10,26H,1H3,(H,23,27) |
| InChIKey | JPXIIOFOGLAHCQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 181.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|