C21H18N6O6S — CID 171333719
2-cyano-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 171333719) has the molecular formula C21H18N6O6S and a molecular weight of 482.48 g/mol. Its IUPAC name is 2-cyano-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333719 |
| Molecular Formula | C21H18N6O6S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 2-cyano-3-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]-N-(5-morpholin-4-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(-c2ccc(C=C(C#N)C(=O)Nc3nnc(N4CCOCC4)s3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18N6O6S/c1-31-14-2-4-16(17(11-14)27(29)30)18-5-3-15(33-18)10-13(12-22)19(28)23-20-24-25-21(34-20)26-6-8-32-9-7-26/h2-5,10-11H,6-9H2,1H3,(H,23,24,28) |
| InChIKey | PAGDZPDCNCMYSX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 156.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|