C22H20N6O4S — CID 170912563
(Z)-2-cyano-N-[5-(4-methylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 170912563) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is (Z)-2-cyano-N-[5-(4-methylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[5-(4-methylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170912563 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (Z)-2-cyano-N-[5-(4-methylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CC1CCN(c2nnc(NC(=O)/C(C#N)=C\c3ccc(-c4ccc([N+](=O)[O-])cc4)o3)s2)CC1 |
| InChI | InChI=1S/C22H20N6O4S/c1-14-8-10-27(11-9-14)22-26-25-21(33-22)24-20(29)16(13-23)12-18-6-7-19(32-18)15-2-4-17(5-3-15)28(30)31/h2-7,12,14H,8-11H2,1H3,(H,24,25,29)/b16-12- |
| InChIKey | QZSVNPPBXZRYLA-VBKFSLOCSA-N |
| XLogP | 4.49 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|