C18H17Cl2N5O2S — CID 170912340
(Z)-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)-N-[5-(4-methylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170912340) has the molecular formula C18H17Cl2N5O2S and a molecular weight of 438.34 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)-N-[5-(4-methylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)-N-[5-(4-methylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170912340 |
| Molecular Formula | C18H17Cl2N5O2S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)-N-[5-(4-methylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | CC1CCN(c2nnc(NC(=O)/C(C#N)=C\c3cc(Cl)c(O)c(Cl)c3)s2)CC1 |
| InChI | InChI=1S/C18H17Cl2N5O2S/c1-10-2-4-25(5-3-10)18-24-23-17(28-18)22-16(27)12(9-21)6-11-7-13(19)15(26)14(20)8-11/h6-8,10,26H,2-5H2,1H3,(H,22,23,27)/b12-6- |
| InChIKey | PTULHQMWPNZBNK-SDQBBNPISA-N |
| XLogP | 4.33 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|