C13H8Cl2N4O4S2 — CID 170917077
(Z)-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170917077) has the molecular formula C13H8Cl2N4O4S2 and a molecular weight of 419.27 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170917077 |
| Molecular Formula | C13H8Cl2N4O4S2 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dichloro-4-hydroxyphenyl)-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2cc(Cl)c(O)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H8Cl2N4O4S2/c1-25(22,23)13-18-12(24-19-13)17-11(21)7(5-16)2-6-3-8(14)10(20)9(15)4-6/h2-4,20H,1H3,(H,17,18,19,21)/b7-2- |
| InChIKey | PDWAYLCXXLGMLU-UQCOIBPSSA-N |
| XLogP | 2.50 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|