C14H11ClN4O3S2 — CID 170910252
(Z)-3-(4-chlorophenyl)-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170910252) has the molecular formula C14H11ClN4O3S2 and a molecular weight of 382.85 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-(4-chlorophenyl)-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170910252 |
| Molecular Formula | C14H11ClN4O3S2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H11ClN4O3S2/c1-2-24(21,22)14-18-13(23-19-14)17-12(20)10(8-16)7-9-3-5-11(15)6-4-9/h3-7H,2H2,1H3,(H,17,18,19,20)/b10-7- |
| InChIKey | OTBGQOMPLMGSAO-YFHOEESVSA-N |
| XLogP | 2.53 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|