C21H18N4O6S3 — CID 171332308
[4-[2-cyano-3-[(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 171332308) has the molecular formula C21H18N4O6S3 and a molecular weight of 518.60 g/mol. Its IUPAC name is [4-[2-cyano-3-[(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[2-cyano-3-[(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171332308 |
| Molecular Formula | C21H18N4O6S3 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | [4-[2-cyano-3-[(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCS(=O)(=O)c1nsc(NC(=O)C(C#N)=Cc2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)n1 |
| InChI | InChI=1S/C21H18N4O6S3/c1-3-33(27,28)21-24-20(32-25-21)23-19(26)16(13-22)12-15-6-8-17(9-7-15)31-34(29,30)18-10-4-14(2)5-11-18/h4-12H,3H2,1-2H3,(H,23,24,25,26) |
| InChIKey | VSCRBBBAAJXNTH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 156.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|