C21H17N5O6S2 — CID 171332426
2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)-3-[4-[(2-nitrophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 171332426) has the molecular formula C21H17N5O6S2 and a molecular weight of 499.53 g/mol. Its IUPAC name is 2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)-3-[4-[(2-nitrophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)-3-[4-[(2-nitrophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171332426 |
| Molecular Formula | C21H17N5O6S2 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-cyano-N-(3-ethylsulfonyl-1,2,4-thiadiazol-5-yl)-3-[4-[(2-nitrophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | CCS(=O)(=O)c1nsc(NC(=O)C(C#N)=Cc2ccc(OCc3ccccc3[N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H17N5O6S2/c1-2-34(30,31)21-24-20(33-25-21)23-19(27)16(12-22)11-14-7-9-17(10-8-14)32-13-15-5-3-4-6-18(15)26(28)29/h3-11H,2,13H2,1H3,(H,23,24,25,27) |
| InChIKey | DVLMJFDVTYJOIC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 165.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|