C20H15N5O6S2 — CID 171332832
2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)-3-[4-[(2-nitrophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 171332832) has the molecular formula C20H15N5O6S2 and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)-3-[4-[(2-nitrophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)-3-[4-[(2-nitrophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171332832 |
| Molecular Formula | C20H15N5O6S2 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)-3-[4-[(2-nitrophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | CS(=O)(=O)c1nnc(NC(=O)C(C#N)=Cc2ccc(OCc3ccccc3[N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C20H15N5O6S2/c1-33(29,30)20-24-23-19(32-20)22-18(26)15(11-21)10-13-6-8-16(9-7-13)31-12-14-4-2-3-5-17(14)25(27)28/h2-10H,12H2,1H3,(H,22,23,26) |
| InChIKey | ATBUJVXFKAIPFU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 165.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|